Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,3,5-Trimethyl-2-Prop-2-Enoxy-Benzene |
|---|---|
| Synonyms | 2-Allyloxy-1,3,5-Trimethyl-Benzene; 2-Allyloxy-1,3,5-Trimethylbenzene; 1,3,5-Trimethyl-2-Prop-2-Enoxy-Benzene |
| Molecular Structure |  |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 |
| CAS Registry Number | 5450-46-4 |
| SMILES | C1=C(C=C(C(=C1C)OCC=C)C)C |
| InChI | 1S/C12H16O/c1-5-6-13-12-10(3)7-9(2)8-11(12)4/h5,7-8H,1,6H2,2-4H3 |
| InChIKey | GABMYMKTOYKZQH-UHFFFAOYSA-N |
| Density | 0.926g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.566°C at 760 mmHg (Cal.) |
| Flash point | 94.269°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Trimethyl-2-Prop-2-Enoxy-Benzene |