Online Database of Chemicals from Around the World
|
CAS#: 54546-95-1 Product: alpha-Methylene-1,3-Benzodioxole-5-Propionaldehyde No suppilers available for the product. |
| Name | alpha-Methylene-1,3-Benzodioxole-5-Propionaldehyde |
|---|---|
| Synonyms | 2-(1,3-Benzodioxol-5-Ylmethyl)Acrolein; Alpha-Methylene-1,3-Benzodioxole-5-Propionaldehyde |
| Molecular Structure |  |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 |
| CAS Registry Number | 54546-95-1 |
| EINECS | 259-212-9 |
| SMILES | C1=C2C(=CC=C1CC(=C)C=O)OCO2 |
| InChI | 1S/C11H10O3/c1-8(6-12)4-9-2-3-10-11(5-9)14-7-13-10/h2-3,5-6H,1,4,7H2 |
| InChIKey | GQPLAQHDCOTNIP-UHFFFAOYSA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.151°C at 760 mmHg (Cal.) |
| Flash point | 147.012°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Methylene-1,3-Benzodioxole-5-Propionaldehyde |