Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Hexyl D-Glucoside |
|---|---|
| Synonyms | (3R,4S,5S,6R)-2-Hexoxy-6-(Hydroxymethyl)Tetrahydropyran-3,4,5-Triol; (3R,4S,5S,6R)-2-Hexoxy-6-Methylol-Tetrahydropyran-3,4,5-Triol |
| Molecular Structure |  |
| Molecular Formula | C12H24O6 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 54549-24-5 |
| EINECS | 259-217-6 |
| SMILES | [C@@H]1(O)[C@@H](O)[C@H](O)[C@H](OC1OCCCCCC)CO |
| InChI | 1S/C12H24O6/c1-2-3-4-5-6-17-12-11(16)10(15)9(14)8(7-13)18-12/h8-16H,2-7H2,1H3/t8-,9-,10+,11-,12?/m1/s1 |
| InChIKey | JVAZJLFFSJARQM-OZRWLHRGSA-N |
| Density | 1.237g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.272°C at 760 mmHg (Cal.) |
| Flash point | 215.231°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexyl D-Glucoside |