Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Hop-17(21)-Ene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.73 |
| CAS Registry Number | 546-99-6 |
| SMILES | [C@@H]34[C@]([C@]2([C@@H]([C@@]1(C(=C(C(C)C)CC1)CC2)C)CC3)C)(CC[C@@H]5[C@@]4(CCCC5(C)C)C)C |
| InChI | 1S/C30H50/c1-20(2)21-12-17-27(5)22(21)13-18-29(7)24(27)10-11-25-28(6)16-9-15-26(3,4)23(28)14-19-30(25,29)8/h20,23-25H,9-19H2,1-8H3/t23-,24+,25+,27-,28-,29+,30+/m0/s1 |
| InChIKey | BJFPMDGPOFJGIR-WWJAXWOYSA-N |
| Density | 0.971g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.281°C at 760 mmHg (Cal.) |
| Flash point | 232.91°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hop-17(21)-Ene |