Online Database of Chemicals from Around the World
|
CAS#: 5462-27-1 Product: (2,5-Diacetyloxy-4-Methyl-Phenyl) Acetate No suppilers available for the product. |
| Name | (2,5-Diacetyloxy-4-Methyl-Phenyl) Acetate |
|---|---|
| Synonyms | (4,5-Diacetoxy-2-Methyl-Phenyl) Acetate; Acetic Acid (4,5-Diacetoxy-2-Methylphenyl) Ester; Acetic Acid (4,5-Diacetoxy-2-Methyl-Phenyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 |
| CAS Registry Number | 5462-27-1 |
| SMILES | C1=C(C(=CC(=C1OC(=O)C)OC(=O)C)C)OC(=O)C |
| InChI | 1S/C13H14O6/c1-7-5-12(18-9(3)15)13(19-10(4)16)6-11(7)17-8(2)14/h5-6H,1-4H3 |
| InChIKey | QISCBMGXIGQAFS-UHFFFAOYSA-N |
| Density | 1.218g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.645°C at 760 mmHg (Cal.) |
| Flash point | 157.751°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,5-Diacetyloxy-4-Methyl-Phenyl) Acetate |