|
CAS#: 5463-78-5 Product: 1-(2-Nitrophenyl)Butane-1,3-Dione No suppilers available for the product. |
| Name | 1-(2-Nitrophenyl)Butane-1,3-Dione |
|---|---|
| Synonyms | 1,3-Butanedione, 1-(2-Nitrophenyl)-; 1,3-Butanedione, 1-(O-Nitrophenyl)-; Nsc21484 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 |
| CAS Registry Number | 5463-78-5 |
| SMILES | C1=C(C(=CC=C1)[N+](=O)[O-])C(CC(C)=O)=O |
| InChI | 1S/C10H9NO4/c1-7(12)6-10(13)8-4-2-3-5-9(8)11(14)15/h2-5H,6H2,1H3 |
| InChIKey | GHVZFKABKYFVRO-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.745°C at 760 mmHg (Cal.) |
| Flash point | 173.947°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Nitrophenyl)Butane-1,3-Dione |