| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Crescent Chemical Co. Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Dinitrodurene |
|---|---|
| Synonyms | 1,2,4,5-Tetramethyl-3,6-Dinitro-Benzene; St5409427 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 |
| CAS Registry Number | 5465-13-4 |
| EINECS | 226-766-8 |
| SMILES | CC1=C(C(=C(C(=C1[N+](=O)[O-])C)C)[N+](=O)[O-])C |
| InChI | 1S/C10H12N2O4/c1-5-6(2)10(12(15)16)8(4)7(3)9(5)11(13)14/h1-4H3 |
| InChIKey | AEPQXGFMAZTUEA-UHFFFAOYSA-N |
| Density | 1.258g/cm3 (Cal.) |
|---|---|
| Melting point | 210°C (Expl.) |
| Boiling point | 363.378°C at 760 mmHg (Cal.) |
| Flash point | 172.891°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dinitrodurene |