|
CAS#: 54661-52-8 Product: 6,6'-Thiobis[2,3-Dihydro-1,1,3,3-Tetramethyl-1H-Inden-5-Ol] No suppilers available for the product. |
| Name | 6,6'-Thiobis[2,3-Dihydro-1,1,3,3-Tetramethyl-1H-Inden-5-Ol] |
|---|---|
| Synonyms | 6-(6-Hydroxy-1,1,3,3-Tetramethyl-Indan-5-Yl)Sulfanyl-1,1,3,3-Tetramethyl-Indan-5-Ol; 6-[(6-Hydroxy-1,1,3,3-Tetramethyl-5-Indanyl)Thio]-1,1,3,3-Tetramethyl-5-Indanol; 6-[(6-Hydroxy-1,1,3,3-Tetramethyl-Indan-5-Yl)Thio]-1,1,3,3-Tetramethyl-Indan-5-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C26H34O2S |
| Molecular Weight | 410.61 |
| CAS Registry Number | 54661-52-8 |
| EINECS | 259-281-5 |
| SMILES | C3=C(SC2=CC1=C(C(CC1(C)C)(C)C)C=C2O)C(=CC4=C3C(CC4(C)C)(C)C)O |
| InChI | 1S/C26H34O2S/c1-23(2)13-25(5,6)17-11-21(19(27)9-15(17)23)29-22-12-18-16(10-20(22)28)24(3,4)14-26(18,7)8/h9-12,27-28H,13-14H2,1-8H3 |
| InChIKey | IQAXMKPWRISDJK-UHFFFAOYSA-N |
| Density | 1.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.87°C at 760 mmHg (Cal.) |
| Flash point | 252.443°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,6'-Thiobis[2,3-Dihydro-1,1,3,3-Tetramethyl-1H-Inden-5-Ol] |