Online Database of Chemicals from Around the World
| Name | 1-(Bromo-Naphthalen-1-Yl-Methyl)Naphthalene |
|---|---|
| Synonyms | 1-[Bromo-(1-Naphthyl)Methyl]Naphthalene; 1-(Bromo-Naphthalen-1-Yl-Methyl)Naphthalene; Ncistruc1_001175 |
| Molecular Structure |  |
| Molecular Formula | C21H15Br |
| Molecular Weight | 347.25 |
| CAS Registry Number | 5467-20-9 |
| SMILES | C1=CC=CC2=CC=CC(=C12)C(Br)C4=C3C=CC=CC3=CC=C4 |
| InChI | 1S/C21H15Br/c22-21(19-13-5-9-15-7-1-3-11-17(15)19)20-14-6-10-16-8-2-4-12-18(16)20/h1-14,21H |
| InChIKey | JTXUIHPHBAGZMF-UHFFFAOYSA-N |
| Density | 1.383g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.406°C at 760 mmHg (Cal.) |
| Flash point | 239.267°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Bromo-Naphthalen-1-Yl-Methyl)Naphthalene |
