Online Database of Chemicals from Around the World
| Name | 2,3,4-Trichloroaniline |
|---|---|
| Synonyms | (2,3,4-Trichlorophenyl)Amine; Sbb003586; 176982_Aldrich |
| Molecular Structure |  |
| Molecular Formula | C6H4Cl3N |
| Molecular Weight | 196.46 |
| CAS Registry Number | 54686-91-8 |
| SMILES | C1=C(C(=C(Cl)C(=C1)N)Cl)Cl |
| InChI | 1S/C6H4Cl3N/c7-3-1-2-4(10)6(9)5(3)8/h1-2H,10H2 |
| InChIKey | RRJUYQOFOMFVQS-UHFFFAOYSA-N |
| Density | 1.54g/cm3 (Cal.) |
|---|---|
| Melting point | 67°C (Expl.) |
| Boiling point | 288.571°C at 760 mmHg (Cal.) |
| Flash point | 128.324°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4-Trichloroaniline |
