Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-Chloronaphthalene-1-Carbaldehyde |
|---|---|
| Synonyms | 4-Chloro-1-Naphthalenecarboxaldehyde; Nsc26050 |
| Molecular Structure |  |
| Molecular Formula | C11H7ClO |
| Molecular Weight | 190.63 |
| CAS Registry Number | 5471-26-1 |
| SMILES | C2=C(C1=CC=CC=C1C(=C2)Cl)C=O |
| InChI | 1S/C11H7ClO/c12-11-6-5-8(7-13)9-3-1-2-4-10(9)11/h1-7H |
| InChIKey | DDYBAABYDNWVPI-UHFFFAOYSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.186°C at 760 mmHg (Cal.) |
| Flash point | 159.741°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloronaphthalene-1-Carbaldehyde |