Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 5-Methyl-2-Propyl-1H-Benzimidazole |
|---|---|
| Synonyms | Nsc29566 |
| Molecular Structure |  |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 |
| CAS Registry Number | 5473-06-3 |
| SMILES | C1=C(C)C=CC2=C1[NH]C(=N2)CCC |
| InChI | 1S/C11H14N2/c1-3-4-11-12-9-6-5-8(2)7-10(9)13-11/h5-7H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | RCVFZYIDHRLOHX-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.565°C at 760 mmHg (Cal.) |
| Flash point | 185.653°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-2-Propyl-1H-Benzimidazole |