Online Database of Chemicals from Around the World
| Name | 5,8-Dihydroxyflavone |
|---|---|
| Synonyms | 5,8-Dihydroxy-2-Phenyl-Chromen-4-One; 5,8-Dihydroxy-2-Phenyl-4-Chromenone; 5,8-Dihydroxy-2-Phenyl-Chromone |
| Molecular Structure |  |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.24 |
| CAS Registry Number | 548-58-3 |
| SMILES | C1=CC(=C2C(=C1O)C(=O)C=C(O2)C3=CC=CC=C3)O |
| InChI | 1S/C15H10O4/c16-10-6-7-11(17)15-14(10)12(18)8-13(19-15)9-4-2-1-3-5-9/h1-8,16-17H |
| InChIKey | KYLWJAUHHPTDDH-UHFFFAOYSA-N |
| Density | 1.443g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.418°C at 760 mmHg (Cal.) |
| Flash point | 194.795°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,8-Dihydroxyflavone |
