| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Analytical chemistry >> Standard >> Forensic and veterinary standards |
|---|---|
| Name | Drofenine Hydrochloride |
| Synonyms | 2-Diethylaminoethyl 2-Cyclohexyl-2-Phenyl-Acetate Hydrochloride; 2-Cyclohexyl-2-Phenylacetic Acid 2-Diethylaminoethyl Ester Hydrochloride; 2-Cyclohexyl-2-Phenyl-Acetic Acid 2-Diethylaminoethyl Ester Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C20H32ClNO2 |
| Molecular Weight | 353.93 |
| CAS Registry Number | 548-66-3 |
| EINECS | 208-954-1 |
| SMILES | [H+].C2=C(C(C1CCCCC1)C(OCCN(CC)CC)=O)C=CC=C2.[Cl-] |
| InChI | 1S/C20H31NO2.ClH/c1-3-21(4-2)15-16-23-20(22)19(17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5,7-8,11-12,18-19H,3-4,6,9-10,13-16H2,1-2H3;1H |
| InChIKey | WIELVDXKOYPANK-UHFFFAOYSA-N |
| Boiling point | 417.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 124.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Drofenine Hydrochloride |