Online Database of Chemicals from Around the World
|
CAS#: 54881-56-0 Product: cis-1,3,4,8b-Tetrahydro-4a(2H)-Biphenylenol No suppilers available for the product. |
| Name | cis-1,3,4,8b-Tetrahydro-4a(2H)-Biphenylenol |
|---|---|
| Synonyms | 4A(2H)-Biphenylenol, 1,3,4,8B-Tetrahydro-, Cis-; Cis-1,3,4,8B-Tetrahydro-4A(2H)-Biphenylenol |
| Molecular Structure |  |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 |
| CAS Registry Number | 54881-56-0 |
| SMILES | C1=CC2=C(C=C1)C3(C2CCCC3)O |
| InChI | 1S/C12H14O/c13-12-8-4-3-7-11(12)9-5-1-2-6-10(9)12/h1-2,5-6,11,13H,3-4,7-8H2 |
| InChIKey | RINGNMPHLXPJRL-UHFFFAOYSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Melting point | 111-112°C (Expl.) |
| Boiling point | 310.002°C at 760 mmHg (Cal.) |
| Flash point | 114.405°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis-1,3,4,8b-Tetrahydro-4a(2H)-Biphenylenol |