| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| PepTech Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (781) 273-5400 | |||
![]() |
service@peptechcorp.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Hydrocarbon compounds and their derivatives >> Cyclic hydrocarbon |
|---|---|
| Name | (2S,3R)-2-Decyl-3-(5-methylhexyl)oxirane |
| Synonyms | (2S-Cis)-7,8-Epoxy-2-Methyloctadecane; Disparlure (2S-Cis)- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H38O |
| Molecular Weight | 282.51 |
| CAS Registry Number | 54910-51-9 |
| EINECS | 259-390-8 |
| SMILES | [C@H]1(O[C@@H]1CCCCC(C)C)CCCCCCCCCC |
| InChI | 1S/C19H38O/c1-4-5-6-7-8-9-10-11-15-18-19(20-18)16-13-12-14-17(2)3/h17-19H,4-16H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | HFOFYNMWYRXIBP-RBUKOAKNSA-N |
| Density | 0.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.6±10.0°C at 760 mmHg (Cal.) |
| Flash point | 139.7±15.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S,3R)-2-Decyl-3-(5-methylhexyl)oxirane |