Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-Bromophenylarsonic Acid |
|---|---|
| Synonyms | Antineoplastic-10875; Nsc10875 |
| Molecular Structure |  |
| Molecular Formula | C6H6AsBrO3 |
| Molecular Weight | 280.94 |
| CAS Registry Number | 55048-80-1 |
| SMILES | C1=CC(=CC=C1[As](O)(O)=O)Br |
| InChI | 1S/C6H6AsBrO3/c8-6-3-1-5(2-4-6)7(9,10)11/h1-4H,(H2,9,10,11) |
| InChIKey | RLRUFMQAMUHYAA-UHFFFAOYSA-N |
| Boiling point | 473.424°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 240.118°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromophenylarsonic Acid |