Online Database of Chemicals from Around the World
|
CAS#: 5508-42-9 Product: 2-(Dimethylsulfanylidene)indane-1,3-dione No suppilers available for the product. |
| Name | 2-(Dimethylsulfanylidene)indane-1,3-dione |
|---|---|
| Synonyms | 2-(Dimethyl-$L^{4}-Sulfanylidene)Indane-1,3-Dione; 2-(Dimethyl-$L^{4}-Sulfanylidene)Indane-1,3-Quinone; Sulfonium,Dimethyl-2,3-Dihydro-1,3-Dioxo-1H-Inden-2-Ylide |
| Molecular Structure |  |
| Molecular Formula | C11H10O2S |
| Molecular Weight | 206.26 |
| CAS Registry Number | 5508-42-9 |
| SMILES | C1=CC=CC2=C1C(=O)C(=[S](C)C)C2=O |
| InChI | 1S/C11H10O2S/c1-14(2)11-9(12)7-5-3-4-6-8(7)10(11)13/h3-6H,1-2H3 |
| InChIKey | DWQOALBKXAPECZ-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.782°C at 760 mmHg (Cal.) |
| Flash point | 207.677°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Dimethylsulfanylidene)indane-1,3-dione |