Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | O-Benzyl-N-Formyl-L-Serine |
|---|---|
| Synonyms | FOR-SER(BZL)-OH |
| Molecular Structure |  |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 5513-74-6 |
| SMILES | C1=CC=C(C=C1)COC[C@@H](C(=O)O)NC=O |
| InChI | 1S/C11H13NO4/c13-8-12-10(11(14)15)7-16-6-9-4-2-1-3-5-9/h1-5,8,10H,6-7H2,(H,12,13)(H,14,15)/t10-/m0/s1 |
| InChIKey | KIEYZJGRXMKITN-JTQLQIEISA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.1±45.0°C at 760 mmHg (Cal.) |
| Flash point | 240.5±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-Benzyl-N-Formyl-L-Serine |