Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,4,5-Tris(1-Methylethyl)-Phenol |
|---|---|
| Synonyms | 2,4,5-Triisopropylphenol; Phenol, 2,4,5-Tris(1-Methylethyl)- |
| Molecular Structure |  |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 55154-67-1 |
| EINECS | 259-506-7 |
| SMILES | C1=C(C(=CC(=C1C(C)C)C(C)C)O)C(C)C |
| InChI | 1S/C15H24O/c1-9(2)12-7-14(11(5)6)15(16)8-13(12)10(3)4/h7-11,16H,1-6H3 |
| InChIKey | MMALDENJQINSHY-UHFFFAOYSA-N |
| Density | 0.926g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.745°C at 760 mmHg (Cal.) |
| Flash point | 133.06°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,5-Tris(1-Methylethyl)-Phenol |