Online Database of Chemicals from Around the World
|
CAS#: 5516-46-1 Product: 2-(Ethylthio)-4,6-Bis(Trichloromethyl)-1,3,5-Triazine No suppilers available for the product. |
| Name | 2-(Ethylthio)-4,6-Bis(Trichloromethyl)-1,3,5-Triazine |
|---|---|
| Synonyms | 2-(Ethylthio)-4,6-Bis(Trichloromethyl)-1,3,5-Triazine; 2-(Ethylthio)-4,6-Bis(Trichloromethyl)-S-Triazine; 1,3,5-Triazine, 2-(Ethylthio)-4,6-Bis(Trichloromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C7H5Cl6N3S |
| Molecular Weight | 375.91 |
| CAS Registry Number | 5516-46-1 |
| SMILES | C(SC1=NC(=NC(=N1)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl)C |
| InChI | 1S/C7H5Cl6N3S/c1-2-17-5-15-3(6(8,9)10)14-4(16-5)7(11,12)13/h2H2,1H3 |
| InChIKey | GXCJDHJIPHAPGL-UHFFFAOYSA-N |
| Density | 1.728g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.839°C at 760 mmHg (Cal.) |
| Flash point | 195.011°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Ethylthio)-4,6-Bis(Trichloromethyl)-1,3,5-Triazine |