Online Database of Chemicals from Around the World
|
CAS#: 55294-31-0 Product: [1-(3,4-Dichlorophenyl)Ethyl]Hydrazine No suppilers available for the product. |
| Name | [1-(3,4-Dichlorophenyl)Ethyl]Hydrazine |
|---|---|
| Synonyms | (1-(3,4-Dichlorophenyl)Ethyl)Hydrazine |
| Molecular Structure | ![CAS#: 55294-31-0， [1-(3,4-Dichlorophenyl)Ethyl]Hydrazine](/moreStructures/55294-31-0.gif) |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 |
| CAS Registry Number | 55294-31-0 |
| EINECS | 259-574-8 |
| SMILES | C1=C(C(=CC(=C1)C(NN)C)Cl)Cl |
| InChI | 1S/C8H10Cl2N2/c1-5(12-11)6-2-3-7(9)8(10)4-6/h2-5,12H,11H2,1H3 |
| InChIKey | ZHVMMRGELMHLJB-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.594°C at 760 mmHg (Cal.) |
| Flash point | 153.738°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [1-(3,4-Dichlorophenyl)Ethyl]Hydrazine |