| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Magnesium Benzoate |
|---|---|
| Synonyms | Magnesium Benzoate; St5444402 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10MgO4 |
| Molecular Weight | 266.54 |
| CAS Registry Number | 553-70-8 |
| EINECS | 209-045-2 |
| SMILES | C1=CC=CC=C1C([O-])=O.C2=C(C([O-])=O)C=CC=C2.[Mg++] |
| InChI | 1S/2C7H6O2.Mg/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);/q;;+2/p-2 |
| InChIKey | PJJZFXPJNUVBMR-UHFFFAOYSA-L |
| Boiling point | 249.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 111.4°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Magnesium Benzoate |