|
CAS#: 5543-97-5 Product: 2-(4-Methoxyphenyl)-1,2-Diphenyl-Ethanone No suppilers available for the product. |
| Name | 2-(4-Methoxyphenyl)-1,2-Diphenyl-Ethanone |
|---|---|
| Synonyms | Nsc41231 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.37 |
| CAS Registry Number | 5543-97-5 |
| SMILES | C1=CC=C(C=C1)C(=O)C(C2=CC=C(C=C2)OC)C3=CC=CC=C3 |
| InChI | 1S/C21H18O2/c1-23-19-14-12-17(13-15-19)20(16-8-4-2-5-9-16)21(22)18-10-6-3-7-11-18/h2-15,20H,1H3 |
| InChIKey | OSTWOIBSEBPRSM-UHFFFAOYSA-N |
| Density | 1.122g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.697°C at 760 mmHg (Cal.) |
| Flash point | 195.838°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Methoxyphenyl)-1,2-Diphenyl-Ethanone |