Online Database of Chemicals from Around the World
|
CAS#: 55497-53-5 Product: 4,6,8-Megastigmatriene No suppilers available for the product. |
| Name | 4,6,8-Megastigmatriene |
|---|---|
| Synonyms | 6-But-2-Enylidene-1,5,5-Trimethylcyclohexene; (6Z)-6-[(E)-But-2-Enylidene]-1,5,5-Trimethyl-Cyclohexene; 6-But-2-Enylidene-1,5,5-Trimethyl-Cyclohexene |
| Molecular Structure |  |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 |
| CAS Registry Number | 55497-53-5 |
| SMILES | CC1(C(/C(=CCC1)C)=C/C=C/C)C |
| InChI | 1S/C13H20/c1-5-6-9-12-11(2)8-7-10-13(12,3)4/h5-6,8-9H,7,10H2,1-4H3/b6-5+,12-9+ |
| InChIKey | BYDQKMZEOZVIJM-HFACTSAFSA-N |
| Density | 0.882g/cm3 (Cal.) |
|---|---|
| Boiling point | 237.929°C at 760 mmHg (Cal.) |
| Flash point | 85.196°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6,8-Megastigmatriene |