Online Database of Chemicals from Around the World
|
CAS#: 5552-46-5 Product: 6-Iodo-8-Nitroquinoline No suppilers available for the product. |
| Name | 6-Iodo-8-Nitroquinoline |
|---|---|
| Synonyms | 6-Iodo-8-nitroquinoline |
| Molecular Formula | C9H5IN2O2 |
| Molecular Weight | 300.05 |
| CAS Registry Number | 5552-46-5 |
| SMILES | [O-][N+](=O)c1cc(I)cc2cccnc12 |
| InChI | 1S/C9H5IN2O2/c10-7-4-6-2-1-3-11-9(6)8(5-7)12(13)14/h1-5H |
| InChIKey | MNONEVLFFGBYHO-UHFFFAOYSA-N |
| Density | 1.991g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.33°C at 760 mmHg (Cal.) |
| Flash point | 192.284°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Iodo-8-Nitroquinoline |