Online Database of Chemicals from Around the World
|
CAS#: 55582-75-7 Product: 17-Phenylprostaglandin F2alpha No suppilers available for the product. |
| Name | 17-Phenylprostaglandin F2alpha |
|---|---|
| Synonyms | (Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(E,3S)-3-Hydroxy-5-Phenyl-Oct-1-Enyl]Cyclopentyl]Hept-5-Enoic Acid; 17-Phenyl-Pgf2alpha; 17-Phenylprostaglandin F2alpha |
| Molecular Structure |  |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.58 |
| CAS Registry Number | 55582-75-7 |
| SMILES | [C@H]1([C@H]([C@@H](O)C[C@H]1O)C\C=C/CCCC(=O)O)\C=C\[C@@H](O)CC(C2=CC=CC=C2)CCC |
| InChI | 1S/C26H38O5/c1-2-10-20(19-11-6-5-7-12-19)17-21(27)15-16-23-22(24(28)18-25(23)29)13-8-3-4-9-14-26(30)31/h3,5-8,11-12,15-16,20-25,27-29H,2,4,9-10,13-14,17-18H2,1H3,(H,30,31)/b8-3-,16-15+/t20?,21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | GEADEWLQJFNDLL-GNQOZLGHSA-N |
| Density | 1.168g/cm3 (Cal.) |
|---|---|
| Boiling point | 614.668°C at 760 mmHg (Cal.) |
| Flash point | 339.557°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17-Phenylprostaglandin F2alpha |