Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-(4-Bromophenyl)sulfamide |
|---|---|
| Synonyms | N-(4-bromophenyl)sulfamide |
| Molecular Structure |  |
| Molecular Formula | C6H7BrN2O2S |
| Molecular Weight | 251.10 |
| CAS Registry Number | 556068-14-5 |
| SMILES | C1=CC(=CC=C1NS(=O)(=O)N)Br |
| InChI | 1S/C6H7BrN2O2S/c7-5-1-3-6(4-2-5)9-12(8,10)11/h1-4,9H,(H2,8,10,11) |
| InChIKey | GNUOARQRACPGBC-UHFFFAOYSA-N |
| Density | 1.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.3±44.0°C at 760 mmHg (Cal.) |
| Flash point | 183.8±28.4°C (Cal.) |
| Refractive index | 1.683 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Bromophenyl)sulfamide |