Online Database of Chemicals from Around the World
|
CAS#: 55620-55-8 Product: 3-(2-Nitroimidazol-1-Yl)Propan-1-Ol No suppilers available for the product. |
| Name | 3-(2-Nitroimidazol-1-Yl)Propan-1-Ol |
|---|---|
| Synonyms | 3-(2-Nitro-1-Imidazolyl)Propan-1-Ol; Nsc302985 |
| Molecular Structure |  |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 |
| CAS Registry Number | 55620-55-8 |
| SMILES | C1=CN=C([N]1CCCO)[N+]([O-])=O |
| InChI | 1S/C6H9N3O3/c10-5-1-3-8-4-2-7-6(8)9(11)12/h2,4,10H,1,3,5H2 |
| InChIKey | MYVTUHZISIPWLL-UHFFFAOYSA-N |
| Density | 1.441g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.271°C at 760 mmHg (Cal.) |
| Flash point | 206.159°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Nitroimidazol-1-Yl)Propan-1-Ol |