Online Database of Chemicals from Around the World
|
CAS#: 55649-90-6 Product: Trimethylsilyl 2-[Bis(Trimethylsilyl)Amino]Butanoate No suppilers available for the product. |
| Name | Trimethylsilyl 2-[Bis(Trimethylsilyl)Amino]Butanoate |
|---|---|
| Synonyms | Butanoic acid, 2-amino, O,N,N-tris-TMS |
| Molecular Structure | ![CAS#: 55649-90-6， Trimethylsilyl 2-[Bis(Trimethylsilyl)Amino]Butanoate](/moreStructures/55649-90-6.gif) |
| Molecular Formula | C13H33NO2Si3 |
| Molecular Weight | 319.66 |
| CAS Registry Number | 55649-90-6 |
| SMILES | O=C(O[Si](C)(C)C)C(N([Si](C)(C)C)[Si](C)(C)C)CC |
| InChI | 1S/C13H33NO2Si3/c1-11-12(13(15)16-19(8,9)10)14(17(2,3)4)18(5,6)7/h12H,11H2,1-10H3 |
| InChIKey | CGHQUVPGAYBCNN-UHFFFAOYSA-N |
| Density | 0.884g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.853°C at 760 mmHg (Cal.) |
| Flash point | 129.703°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl 2-[Bis(Trimethylsilyl)Amino]Butanoate |