Online Database of Chemicals from Around the World
|
CAS#: 5566-34-7 Product: gamma-Chlordane No suppilers available for the product. |
| Name | gamma-Chlordane |
|---|---|
| Synonyms | 2,2,4,5,6,7,8,8-Octachloro-3A,4,7,7A-Tetrahydro-4,7-Methanoindan; 4,7-Methano-1H-Indene, 2,2,4,5,6,7,8,8-Octachloro-2,3,3A,4,7,7A-Hexahydro- (9Ci); 4,7-Methanoindan, 2,2,4,5,6,7,8,8-Octachloro-3A,4,7,7A-Tetrahydro-, Stereoisomer |
| Molecular Structure |  |
| Molecular Formula | C10H6Cl8 |
| Molecular Weight | 409.78 |
| CAS Registry Number | 5566-34-7 |
| EINECS | 226-938-2 |
| SMILES | C2C1C3(C(C(Cl)(C1CC2(Cl)Cl)C(=C3Cl)Cl)(Cl)Cl)Cl |
| InChI | 1S/C10H6Cl8/c11-5-6(12)9(16)4-2-7(13,14)1-3(4)8(5,15)10(9,17)18/h3-4H,1-2H2 |
| InChIKey | JBZJEPYXXVKOKF-UHFFFAOYSA-N |
| Density | 1.816g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.935°C at 760 mmHg (Cal.) |
| Flash point | 208.973°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for gamma-Chlordane |