Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-Nitro-1H-Pyrrole-2-Sulfonamide |
|---|---|
| Synonyms | 1H-Pyrrole-2-sulfonamide,5-nitro-; 5-nitro-1H-pyrrole-2-sulfonamide |
| Molecular Structure |  |
| Molecular Formula | C4H5N3O4S |
| Molecular Weight | 191.17 |
| CAS Registry Number | 55673-69-3 |
| SMILES | c1cc([nH]c1[N+](=O)[O-])S(=O)(=O)N |
| InChI | 1S/C4H5N3O4S/c5-12(10,11)4-2-1-3(6-4)7(8)9/h1-2,6H,(H2,5,10,11) |
| InChIKey | PSAQFLVJIJPKOX-UHFFFAOYSA-N |
| Density | 1.761g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.787°C at 760 mmHg (Cal.) |
| Flash point | 256.667°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitro-1H-Pyrrole-2-Sulfonamide |