Online Database of Chemicals from Around the World
|
CAS#: 55720-41-7 Product: 1,2,3,7-Tetrachloronaphthalene No suppilers available for the product. |
| Name | 1,2,3,7-Tetrachloronaphthalene |
|---|---|
| Synonyms | Naphthalene, 1,2,3,7-Tetrachloro; Naphthalene, 1,2,3,7-Tetrachloro- |
| Molecular Structure |  |
| Molecular Formula | C10H4Cl4 |
| Molecular Weight | 265.95 |
| CAS Registry Number | 55720-41-7 |
| SMILES | C2=CC1=CC(=C(C(=C1C=C2Cl)Cl)Cl)Cl |
| InChI | 1S/C10H4Cl4/c11-6-2-1-5-3-8(12)10(14)9(13)7(5)4-6/h1-4H |
| InChIKey | AULMCNDOHMTPGC-UHFFFAOYSA-N |
| Density | 1.552g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.098°C at 760 mmHg (Cal.) |
| Flash point | 168.985°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,7-Tetrachloronaphthalene |