Online Database of Chemicals from Around the World
|
CAS#: 55724-87-3 Product: 4-(4-Hydroxy-3-Pentanoylbenzyl)Phenyl Valerate No suppilers available for the product. |
| Name | 4-(4-Hydroxy-3-Pentanoylbenzyl)Phenyl Valerate |
|---|---|
| Synonyms | 4-(4-Hydroxy-3-pentanoylbenzyl)phenyl pentanoate # |
| Molecular Structure |  |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 |
| CAS Registry Number | 55724-87-3 |
| SMILES | O=C(c1cc(ccc1O)Cc2ccc(OC(=O)CCCC)cc2)CCCC |
| InChI | 1S/C23H28O4/c1-3-5-7-21(24)20-16-18(11-14-22(20)25)15-17-9-12-19(13-10-17)27-23(26)8-6-4-2/h9-14,16,25H,3-8,15H2,1-2H3 |
| InChIKey | OGMUHXYVTCHBQO-UHFFFAOYSA-N |
| Density | 1.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.048°C at 760 mmHg (Cal.) |
| Flash point | 170.637°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Hydroxy-3-Pentanoylbenzyl)Phenyl Valerate |