Online Database of Chemicals from Around the World
|
CAS#: 55786-24-8 Product: 7,8-Dehydrorutaecarpine No suppilers available for the product. |
| Name | 7,8-Dehydrorutaecarpine |
|---|---|
| Synonyms | Indolo(2',3':3,4)Pyrido(2,1-B)Quinazolin-5(13H)-One |
| Molecular Structure |  |
| Molecular Formula | C18H11N3O |
| Molecular Weight | 285.30 |
| CAS Registry Number | 55786-24-8 |
| SMILES | C1=C2C(=CC=C1)N=C3N(C2=O)C=CC4=C3[NH]C5=C4C=CC=C5 |
| InChI | 1S/C18H11N3O/c22-18-13-6-2-4-8-15(13)20-17-16-12(9-10-21(17)18)11-5-1-3-7-14(11)19-16/h1-10,19H |
| InChIKey | KLONOPPMRIDVGM-UHFFFAOYSA-N |
| Density | 1.446g/cm3 (Cal.) |
|---|---|
| Boiling point | 560.651°C at 760 mmHg (Cal.) |
| Flash point | 292.871°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8-Dehydrorutaecarpine |