Online Database of Chemicals from Around the World
|
CAS#: 5580-86-9 Product: 4-Methylcinnoline 1-Oxide No suppilers available for the product. |
| Name | 4-Methylcinnoline 1-Oxide |
|---|---|
| Synonyms | 4-Methyl-1-Oxido-Cinnolin-1-Ium; 4-Methylcinnoline 1-Oxide; Cinnoline, 4-Methyl-, 1-Oxide |
| Molecular Structure |  |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 |
| CAS Registry Number | 5580-86-9 |
| SMILES | C1=N[N+](=C2C(=C1C)C=CC=C2)[O-] |
| InChI | 1S/C9H8N2O/c1-7-6-10-11(12)9-5-3-2-4-8(7)9/h2-6H,1H3 |
| InChIKey | BOUMDIGPGFJRGZ-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.895°C at 760 mmHg (Cal.) |
| Flash point | 154.525°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylcinnoline 1-Oxide |