Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,4-Dibromo-6-Phenylphenol |
|---|---|
| Synonyms | 2,4-Dibromo-6-Phenyl-Phenol; [1,1'-Biphenyl]-2-Ol, 3,5-Dibromo-; Nsc95809 |
| Molecular Structure |  |
| Molecular Formula | C12H8Br2O |
| Molecular Weight | 328.00 |
| CAS Registry Number | 55815-20-8 |
| SMILES | C1=C(Br)C=C(C(=C1C2=CC=CC=C2)O)Br |
| InChI | 1S/C12H8Br2O/c13-9-6-10(12(15)11(14)7-9)8-4-2-1-3-5-8/h1-7,15H |
| InChIKey | FLAJYIKIPQZYAY-UHFFFAOYSA-N |
| Density | 1.768g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.356°C at 760 mmHg (Cal.) |
| Flash point | 153.594°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dibromo-6-Phenylphenol |