Online Database of Chemicals from Around the World
| Name | 2,6-Dimethylphenyl Methacrylate |
|---|---|
| Synonyms | 2,6-xylyl methacrylate |
| Molecular Structure |  |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 55879-73-7 |
| EINECS | 259-875-4 |
| SMILES | O=C(Oc1c(cccc1C)C)\C(=C)C |
| InChI | 1S/C12H14O2/c1-8(2)12(13)14-11-9(3)6-5-7-10(11)4/h5-7H,1H2,2-4H3 |
| InChIKey | UWDKOKUSUKKWOT-UHFFFAOYSA-N |
| Density | 1.015g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.703°C at 760 mmHg (Cal.) |
| Flash point | 117.137°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dimethylphenyl Methacrylate |
