Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,4-Dinitrophenylhydrazine Hydrochloride |
|---|---|
| Synonyms | 2,4-Dinitrophenylhydrazinium(1+) Chloride; 2,4-Dinitrophenyl Hydrazine Hydrochloride |
| Molecular Structure |  |
| Molecular Formula | C6H7ClN4O4 |
| Molecular Weight | 234.60 |
| CAS Registry Number | 55907-61-4 |
| EINECS | 259-888-5 |
| SMILES | [H+].C1=C([N+]([O-])=O)C=CC(=C1[N+]([O-])=O)NN.[Cl-] |
| InChI | 1S/C6H6N4O4.ClH/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14;/h1-3,8H,7H2;1H |
| InChIKey | PUYFAZQODQZOFK-UHFFFAOYSA-N |
| Boiling point | 378.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 182.8°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,4-Dinitrophenylhydrazine Hydrochloride |