Online Database of Chemicals from Around the World
|
CAS#: 55955-07-2 Product: Austrobailignan 1 No suppilers available for the product. |
| Name | Austrobailignan 1 |
|---|---|
| Synonyms | Austrobailignan-1; Austrobailignan 1; C10546 |
| Molecular Structure |  |
| Molecular Formula | C21H18O7 |
| Molecular Weight | 382.37 |
| CAS Registry Number | 55955-07-2 |
| SMILES | [C@H]1(C3=C(C[C@H]2COC([C@H]12)=O)C=C4C(=C3)OCO4)C6=CC(=C5OCOC5=C6)OC |
| InChI | 1S/C21H18O7/c1-23-16-4-11(5-17-20(16)28-9-27-17)18-13-6-15-14(25-8-26-15)3-10(13)2-12-7-24-21(22)19(12)18/h3-6,12,18-19H,2,7-9H2,1H3/t12-,18+,19-/m0/s1 |
| InChIKey | GROYKMASYUMFER-RQUSPXKASA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 568.762°C at 760 mmHg (Cal.) |
| Flash point | 251.167°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Austrobailignan 1 |