Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl Bicyclo[2.2.1]Hepta-2,5-Diene-7-Carboxylate |
|---|---|
| Synonyms | methyl bicyclo[2.2.1]hepta-2,5-diene-7-carboxylate |
| Molecular Structure | ![CAS#: 5597-69-3， Methyl Bicyclo[2.2.1]Hepta-2,5-Diene-7-Carboxylate](/moreStructures/5597-69-3.gif) |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.17 |
| CAS Registry Number | 5597-69-3 |
| SMILES | O=C(OC)C2C/1\C=C/C2\C=C\1 |
| InChI | 1S/C9H10O2/c1-11-9(10)8-6-2-3-7(8)5-4-6/h2-8H,1H3 |
| InChIKey | BSIXIXXDCMNDNR-UHFFFAOYSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 201.03°C at 760 mmHg (Cal.) |
| Flash point | 65.827°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl Bicyclo[2.2.1]Hepta-2,5-Diene-7-Carboxylate |