Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6352-9955 | |||
|
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | p-Phenylenediamine Hydrochloride |
|---|---|
| Synonyms | P-Phenylenediamine Hydrochloride; 4-Dimethylaminoaniline Hydrochloride |
| Molecular Structure |  |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.60 |
| CAS Registry Number | 55972-71-9 |
| EINECS | 259-926-0 |
| SMILES | [H+].C1=C(N)C=CC(=C1)N.[Cl-] |
| InChI | 1S/C6H8N2.ClH/c7-5-1-2-6(8)4-3-5;/h1-4H,7-8H2;1H |
| InChIKey | MCIURFJELJKSNV-UHFFFAOYSA-N |
| Boiling point | 267.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 135.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for p-Phenylenediamine Hydrochloride |