| Alfa Pyridines | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 447-3255 | |||
![]() |
sales@pyridines.info | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | API >> Special medicine >> Antidote |
|---|---|
| Name | 1,1'-Trimethylene-Bis(4-Formylpyridinium Bromide) Dioxime |
| Synonyms | Oxo-[[1-[3-[4-(Oxoazaniumylmethylene)-1-Pyridyl]Propyl]-4-Pyridylidene]Methyl]Ammonium Dibromide; Keto-[[1-[3-[4-(Ketoazaniumylmethylene)-1-Pyridyl]Propyl]-4-Pyridylidene]Methyl]Ammonium Dibromide; St5409962 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18Br2N4O2 |
| Molecular Weight | 446.14 |
| CAS Registry Number | 56-97-3 |
| EINECS | 200-304-5 |
| SMILES | [NH+](=O)\C=C2/C=CN(CCCN1C=C\C(C=C1)=C/[NH+]=O)C=C2.[Br-].[Br-] |
| InChI | 1S/C15H16N4O2.2BrH/c20-16-12-14-2-8-18(9-3-14)6-1-7-19-10-4-15(5-11-19)13-17-21;;/h2-5,8-13H,1,6-7H2;2*1H |
| InChIKey | JHZHWVQTOXIXIV-UHFFFAOYSA-N |
| Boiling point | 412.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 203.5°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Guillaume Mercey, Tristan Verdelet, Géraldine Saint-André, Emilie Gillon, Alain Wagner, Rachid Baati, Ludovic Jean, Florian Nachon and Pierre-Yves Renard. First efficient uncharged reactivators for the dephosphylation of poisoned human acetylcholinesterase, Chem. Commun., 2011, 47, 5295. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1'-Trimethylene-Bis(4-Formylpyridinium Bromide) Dioxime |