Online Database of Chemicals from Around the World
|
CAS#: 56003-01-1 Product: 5,7-Dihydroxy-6,8,3',4'-tetramethoxyflavone No suppilers available for the product. |
| Name | 5,7-Dihydroxy-6,8,3',4'-tetramethoxyflavone |
|---|---|
| Synonyms | 2-(3,4-Dimethoxyphenyl)-5,7-Dihydroxy-6,8-Dimethoxy-Chromen-4-One; 2-(3,4-Dimethoxyphenyl)-5,7-Dihydroxy-6,8-Dimethoxy-4-Chromenone; 2-(3,4-Dimethoxyphenyl)-5,7-Dihydroxy-6,8-Dimethoxy-Chromone |
| Molecular Structure |  |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.35 |
| CAS Registry Number | 56003-01-1 |
| SMILES | C1=C(OC)C(=CC=C1C2=CC(C3=C(O2)C(=C(C(=C3O)OC)O)OC)=O)OC |
| InChI | 1S/C19H18O8/c1-23-11-6-5-9(7-13(11)24-2)12-8-10(20)14-15(21)18(25-3)16(22)19(26-4)17(14)27-12/h5-8,21-22H,1-4H3 |
| InChIKey | QCOSAYZZNVASNN-UHFFFAOYSA-N |
| Density | 1.376g/cm3 (Cal.) |
|---|---|
| Boiling point | 631.414°C at 760 mmHg (Cal.) |
| Flash point | 228.766°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7-Dihydroxy-6,8,3',4'-tetramethoxyflavone |