Online Database of Chemicals from Around the World
|
CAS#: 56014-69-8 Product: (E)-3-Isobutylidenephthalide No suppilers available for the product. |
| Name | (E)-3-Isobutylidenephthalide |
|---|---|
| Synonyms | (3Z)-3-(2-Methylpropylidene)Isobenzofuran-1-One; (3Z)-3-(2-Methylpropylidene)-1-Isobenzofuranone; (E)-3-Isobutylidenephthalide |
| Molecular Structure |  |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 |
| CAS Registry Number | 56014-69-8 |
| EINECS | 259-944-9 |
| SMILES | C1=CC2=C(C=C1)\C(=C\C(C)C)OC2=O |
| InChI | 1S/C12H12O2/c1-8(2)7-11-9-5-3-4-6-10(9)12(13)14-11/h3-8H,1-2H3/b11-7- |
| InChIKey | LYSNVWBBICAAMS-XFFZJAGNSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.684°C at 760 mmHg (Cal.) |
| Flash point | 124.399°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-3-Isobutylidenephthalide |