Online Database of Chemicals from Around the World
|
CAS#: 56037-73-1 Product: 5-Bromo-3-Ethyl-3-Phenyl-2,6-Piperidinedione No suppilers available for the product. |
| Name | 5-Bromo-3-Ethyl-3-Phenyl-2,6-Piperidinedione |
|---|---|
| Synonyms | 5-Bromo-3-Ethyl-3-Phenyl-Piperidine-2,6-Dione; 5-Bromo-3-Ethyl-3-Phenyl-Piperidine-2,6-Quinone; Brn 0220101 |
| Molecular Structure |  |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 |
| CAS Registry Number | 56037-73-1 |
| SMILES | C1=CC=CC=C1C2(C(NC(C(C2)Br)=O)=O)CC |
| InChI | 1S/C13H14BrNO2/c1-2-13(9-6-4-3-5-7-9)8-10(14)11(16)15-12(13)17/h3-7,10H,2,8H2,1H3,(H,15,16,17) |
| InChIKey | DLLDWLFSFRVNHQ-UHFFFAOYSA-N |
| Density | 1.41g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.069°C at 760 mmHg (Cal.) |
| Flash point | 215.713°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-3-Ethyl-3-Phenyl-2,6-Piperidinedione |