|
CAS#: 5622-06-0 Product: 6-Chloro-8-Quinolinol No suppilers available for the product. |
| Name | 6-Chloro-8-Quinolinol |
|---|---|
| Synonyms | 6-Chloro-8-hydroxyquinoline; AIDS059746; AIDS-059746 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6ClNO |
| Molecular Weight | 179.60 |
| CAS Registry Number | 5622-06-0 |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)O)Cl |
| InChI | 1S/C9H6ClNO/c10-7-4-6-2-1-3-11-9(6)8(12)5-7/h1-5,12H |
| InChIKey | YFKDOLPRGYKULB-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.5±22.0°C at 760 mmHg (Cal.) |
| Flash point | 161.5±22.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-8-Quinolinol |