|
CAS#: 5623-25-6 Product: 1,2-Di-1,1''-Biphenyl-4-Yl-2-Hydroxyethanone No suppilers available for the product. |
| Name | 1,2-Di-1,1''-Biphenyl-4-Yl-2-Hydroxyethanone |
|---|---|
| Synonyms | Nsc121481; Oprea1_074209 |
| Molecular Structure | ![]() |
| Molecular Formula | C26H20O2 |
| Molecular Weight | 364.44 |
| CAS Registry Number | 5623-25-6 |
| SMILES | C1=CC(=CC=C1C2=CC=CC=C2)C(C(C3=CC=C(C=C3)C4=CC=CC=C4)=O)O |
| InChI | 1S/C26H20O2/c27-25(23-15-11-21(12-16-23)19-7-3-1-4-8-19)26(28)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18,25,27H |
| InChIKey | MGUZTXXISNAEDO-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 569.199°C at 760 mmHg (Cal.) |
| Flash point | 238.772°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Di-1,1''-Biphenyl-4-Yl-2-Hydroxyethanone |