|
CAS#: 56247-84-8 Product: 2-Amino-1,7-Dihydro-7-(2-Hydroxypropyl)-6H-Purin-6-One No suppilers available for the product. |
| Name | 2-Amino-1,7-Dihydro-7-(2-Hydroxypropyl)-6H-Purin-6-One |
|---|---|
| Synonyms | 6H-Purin-6-One, 2-Amino-1,7-Dihydro-7-(2-Hydroxypropyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 |
| CAS Registry Number | 56247-84-8 |
| SMILES | C1=NC2=C([N]1CC(O)C)C(=O)N=C(N2)N |
| InChI | 1S/C8H11N5O2/c1-4(14)2-13-3-10-6-5(13)7(15)12-8(9)11-6/h3-4,14H,2H2,1H3,(H3,9,11,12,15) |
| InChIKey | JVWVMKYNORDKGP-UHFFFAOYSA-N |
| Density | 1.747g/cm3 (Cal.) |
|---|---|
| Boiling point | 556.013°C at 760 mmHg (Cal.) |
| Flash point | 290.066°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-1,7-Dihydro-7-(2-Hydroxypropyl)-6H-Purin-6-One |