Online Database of Chemicals from Around the World
|
CAS#: 5625-44-5 Product: Cyclo(Valylvalyl) No suppilers available for the product. |
| Name | Cyclo(Valylvalyl) |
|---|---|
| Synonyms | 3,6-Diisopropylpiperazine-2,5-Dione; 3,6-Diisopropylpiperazine-2,5-Quinone; 2,5 Piperazinedione, 3,6-Bis(1-Methylethyl)-, (35)-Trans- |
| Molecular Structure |  |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.26 |
| CAS Registry Number | 5625-44-5 |
| SMILES | CC(C1C(NC(C(N1)=O)C(C)C)=O)C |
| InChI | 1S/C10H18N2O2/c1-5(2)7-9(13)12-8(6(3)4)10(14)11-7/h5-8H,1-4H3,(H,11,14)(H,12,13) |
| InChIKey | QGMAWEIDGADSAC-UHFFFAOYSA-N |
| Density | 1.013g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.663°C at 760 mmHg (Cal.) |
| Flash point | 184.793°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyclo(Valylvalyl) |